C22H34FN3O — CID 56545217
N-[3-(azepan-1-yl)propyl]-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 56545217) has the molecular formula C22H34FN3O and a molecular weight of 375.53 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56545217 |
| Molecular Formula | C22H34FN3O |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1)C1CCCN(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C22H34FN3O/c23-21-10-5-8-19(16-21)17-26-14-6-9-20(18-26)22(27)24-11-7-15-25-12-3-1-2-4-13-25/h5,8,10,16,20H,1-4,6-7,9,11-15,17-18H2,(H,24,27) |
| InChIKey | RMBCPAHBAJZFBP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|