C19H29FN4O — CID 119448544
1-[(3-fluorophenyl)methyl]-N-(2-piperazin-1-ylethyl)piperidine-3-carboxamide (PubChem CID 119448544) has the molecular formula C19H29FN4O and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-N-(2-piperazin-1-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-N-(2-piperazin-1-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119448544 |
| Molecular Formula | C19H29FN4O |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-N-(2-piperazin-1-ylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)C1CCCN(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H29FN4O/c20-18-5-1-3-16(13-18)14-24-9-2-4-17(15-24)19(25)22-8-12-23-10-6-21-7-11-23/h1,3,5,13,17,21H,2,4,6-12,14-15H2,(H,22,25) |
| InChIKey | MPBGWIIXZVGKSA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |