C15H21FN4O2 — CID 86859369
1-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]-3-methylurea (PubChem CID 86859369) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]-3-methylurea.
| Compound Name | 1-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]-3-methylurea |
|---|---|
| PubChem CID | 86859369 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)C1CCCN(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H21FN4O2/c1-17-15(22)19-18-14(21)12-5-3-7-20(10-12)9-11-4-2-6-13(16)8-11/h2,4,6,8,12H,3,5,7,9-10H2,1H3,(H,18,21)(H2,17,19,22) |
| InChIKey | FULURKRQLBUAOE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|