C19H24Cl2FN3O — CID 119422659
N-(2-aminophenyl)-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119422659) has the molecular formula C19H24Cl2FN3O and a molecular weight of 400.33 g/mol. Its IUPAC name is N-(2-aminophenyl)-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-aminophenyl)-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119422659 |
| Molecular Formula | C19H24Cl2FN3O |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-(2-aminophenyl)-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1NC(=O)C1CCCN(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H22FN3O.2ClH/c20-16-7-3-5-14(11-16)12-23-10-4-6-15(13-23)19(24)22-18-9-2-1-8-17(18)21;;/h1-3,5,7-9,11,15H,4,6,10,12-13,21H2,(H,22,24);2*1H |
| InChIKey | IFZWVTPVIQVKMA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|