C21H24ClFN2OS — CID 93491105
(3R)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 93491105) has the molecular formula C21H24ClFN2OS and a molecular weight of 406.95 g/mol. Its IUPAC name is (3R)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93491105 |
| Molecular Formula | C21H24ClFN2OS |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (3R)-N-[2-(4-chlorophenyl)sulfanylethyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)[C@@H]1CCCN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H24ClFN2OS/c22-18-5-9-20(10-6-18)27-13-11-24-21(26)17-2-1-12-25(15-17)14-16-3-7-19(23)8-4-16/h3-10,17H,1-2,11-15H2,(H,24,26)/t17-/m1/s1 |
| InChIKey | SRNSUDAEPCHPEO-QGZVFWFLSA-N |
| XLogP | 4.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|