C21H31FN2OS — CID 43922931
N-(2-cyclohexylsulfanylethyl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43922931) has the molecular formula C21H31FN2OS and a molecular weight of 378.56 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43922931 |
| Molecular Formula | C21H31FN2OS |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSC1CCCCC1)C1CCCN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H31FN2OS/c22-19-10-8-17(9-11-19)15-24-13-4-5-18(16-24)21(25)23-12-14-26-20-6-2-1-3-7-20/h8-11,18,20H,1-7,12-16H2,(H,23,25) |
| InChIKey | DOUABADVHFJMNZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|