C23H29ClN2OS — CID 43920787
1-[(4-chlorophenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 43920787) has the molecular formula C23H29ClN2OS and a molecular weight of 417.02 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43920787 |
| Molecular Formula | C23H29ClN2OS |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)C2CCCN(Cc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C23H29ClN2OS/c1-18-4-6-20(7-5-18)17-28-14-12-25-23(27)21-3-2-13-26(16-21)15-19-8-10-22(24)11-9-19/h4-11,21H,2-3,12-17H2,1H3,(H,25,27) |
| InChIKey | ULWGPEZECDOFTE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|