C17H26ClN3O3S2 — CID 28574449
(3R)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide (PubChem CID 28574449) has the molecular formula C17H26ClN3O3S2 and a molecular weight of 420.00 g/mol. Its IUPAC name is (3R)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28574449 |
| Molecular Formula | C17H26ClN3O3S2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3R)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@H](C(=O)NCCSCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H26ClN3O3S2/c1-20(2)26(23,24)21-10-3-4-15(12-21)17(22)19-9-11-25-13-14-5-7-16(18)8-6-14/h5-8,15H,3-4,9-13H2,1-2H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | MUDPGAHWUXPIIW-OAHLLOKOSA-N |
| XLogP | 2.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|