C17H24Cl2N2O3S2 — CID 125042724
(3S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-ethylsulfonylpiperidine-3-carboxamide (PubChem CID 125042724) has the molecular formula C17H24Cl2N2O3S2 and a molecular weight of 439.43 g/mol. Its IUPAC name is (3S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-ethylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-ethylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125042724 |
| Molecular Formula | C17H24Cl2N2O3S2 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (3S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-ethylsulfonylpiperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@H](C(=O)NCCSCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H24Cl2N2O3S2/c1-2-26(23,24)21-8-3-4-13(11-21)17(22)20-7-9-25-12-14-5-6-15(18)10-16(14)19/h5-6,10,13H,2-4,7-9,11-12H2,1H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | HVSBYIDOBPQQMP-ZDUSSCGKSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|