C21H23Cl3N2O4S — CID 133164305
N-[2-(4-chlorophenoxy)ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide (PubChem CID 133164305) has the molecular formula C21H23Cl3N2O4S and a molecular weight of 505.85 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133164305 |
| Molecular Formula | C21H23Cl3N2O4S |
| Molecular Weight | 505.85 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)C1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C21H23Cl3N2O4S/c22-17-5-7-19(8-6-17)30-11-9-25-21(27)15-2-1-10-26(13-15)31(28,29)14-16-3-4-18(23)12-20(16)24/h3-8,12,15H,1-2,9-11,13-14H2,(H,25,27) |
| InChIKey | KHINJXSNFWUYKY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|