C22H26Cl2N2O5S — CID 133164312
1-[(2,4-dichlorophenyl)methylsulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 133164312) has the molecular formula C22H26Cl2N2O5S and a molecular weight of 501.43 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methylsulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenyl)methylsulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133164312 |
| Molecular Formula | C22H26Cl2N2O5S |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methylsulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccccc1OCCNC(=O)C1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C22H26Cl2N2O5S/c1-30-20-6-2-3-7-21(20)31-12-10-25-22(27)16-5-4-11-26(14-16)32(28,29)15-17-8-9-18(23)13-19(17)24/h2-3,6-9,13,16H,4-5,10-12,14-15H2,1H3,(H,25,27) |
| InChIKey | OGLSPSFCVFFTCJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|