C22H24Cl4N2O3S2 — CID 98054404
(3R)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide (PubChem CID 98054404) has the molecular formula C22H24Cl4N2O3S2 and a molecular weight of 570.39 g/mol. Its IUPAC name is (3R)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 98054404 |
| Molecular Formula | C22H24Cl4N2O3S2 |
| Molecular Weight | 570.39 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | (3R)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1c(Cl)cccc1Cl)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C22H24Cl4N2O3S2/c23-17-7-6-16(21(26)11-17)14-33(30,31)28-9-2-3-15(12-28)22(29)27-8-10-32-13-18-19(24)4-1-5-20(18)25/h1,4-7,11,15H,2-3,8-10,12-14H2,(H,27,29)/t15-/m1/s1 |
| InChIKey | CHGVKZXOACOVFY-OAHLLOKOSA-N |
| XLogP | 5.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.39 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|