C21H24ClFN2O3S2 — CID 133167748
1-(benzenesulfonyl)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 133167748) has the molecular formula C21H24ClFN2O3S2 and a molecular weight of 471.02 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133167748 |
| Molecular Formula | C21H24ClFN2O3S2 |
| Molecular Weight | 471.02 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1c(F)cccc1Cl)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H24ClFN2O3S2/c22-19-9-4-10-20(23)18(19)15-29-13-11-24-21(26)16-6-5-12-25(14-16)30(27,28)17-7-2-1-3-8-17/h1-4,7-10,16H,5-6,11-15H2,(H,24,26) |
| InChIKey | UDLFGBOWXTVQAJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.02 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|