C19H23FN2O4S2 — CID 39969578
(3S)-1-(4-fluorophenyl)sulfonyl-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide (PubChem CID 39969578) has the molecular formula C19H23FN2O4S2 and a molecular weight of 426.54 g/mol. Its IUPAC name is (3S)-1-(4-fluorophenyl)sulfonyl-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-fluorophenyl)sulfonyl-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 39969578 |
| Molecular Formula | C19H23FN2O4S2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (3S)-1-(4-fluorophenyl)sulfonyl-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccco1)[C@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H23FN2O4S2/c20-16-5-7-18(8-6-16)28(24,25)22-10-1-3-15(13-22)19(23)21-9-12-27-14-17-4-2-11-26-17/h2,4-8,11,15H,1,3,9-10,12-14H2,(H,21,23)/t15-/m0/s1 |
| InChIKey | DFFLXXJSBDORHI-HNNXBMFYSA-N |
| XLogP | 2.87 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|