C20H26N2O5S2 — CID 33345459
(3S)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 33345459) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is (3S)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 33345459 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (3S)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NCCSCc3ccco3)C2)cc1 |
| InChI | InChI=1S/C20H26N2O5S2/c1-26-17-6-8-19(9-7-17)29(24,25)22-11-2-4-16(14-22)20(23)21-10-13-28-15-18-5-3-12-27-18/h3,5-9,12,16H,2,4,10-11,13-15H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | GJSPERZDKSHJEU-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|