C17H23N5O4S2 — CID 125050673
(3S)-1-(4-methoxyphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-3-carboxamide (PubChem CID 125050673) has the molecular formula C17H23N5O4S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-methoxyphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125050673 |
| Molecular Formula | C17H23N5O4S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NCCSc3ncn[nH]3)C2)cc1 |
| InChI | InChI=1S/C17H23N5O4S2/c1-26-14-4-6-15(7-5-14)28(24,25)22-9-2-3-13(11-22)16(23)18-8-10-27-17-19-12-20-21-17/h4-7,12-13H,2-3,8-11H2,1H3,(H,18,23)(H,19,20,21)/t13-/m0/s1 |
| InChIKey | XNAOCBCVZIEFDH-ZDUSSCGKSA-N |
| XLogP | 1.12 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|