C23H27N5O4S2 — CID 133159576
1-(4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 133159576) has the molecular formula C23H27N5O4S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133159576 |
| Molecular Formula | C23H27N5O4S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCSc3n[nH]c(-c4ccccc4)n3)C2)cc1 |
| InChI | InChI=1S/C23H27N5O4S2/c1-32-19-9-11-20(12-10-19)34(30,31)28-14-5-8-18(16-28)22(29)24-13-15-33-23-25-21(26-27-23)17-6-3-2-4-7-17/h2-4,6-7,9-12,18H,5,8,13-16H2,1H3,(H,24,29)(H,25,26,27) |
| InChIKey | IOHWBIRSMMWVEB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|