C25H31N5O4S2 — CID 125049321
(3S)-1-(4-ethoxy-3-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 125049321) has the molecular formula C25H31N5O4S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is (3S)-1-(4-ethoxy-3-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-ethoxy-3-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125049321 |
| Molecular Formula | C25H31N5O4S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | (3S)-1-(4-ethoxy-3-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NCCSc3n[nH]c(-c4ccccc4)n3)C2)cc1C |
| InChI | InChI=1S/C25H31N5O4S2/c1-3-34-22-12-11-21(16-18(22)2)36(32,33)30-14-7-10-20(17-30)24(31)26-13-15-35-25-27-23(28-29-25)19-8-5-4-6-9-19/h4-6,8-9,11-12,16,20H,3,7,10,13-15,17H2,1-2H3,(H,26,31)(H,27,28,29)/t20-/m0/s1 |
| InChIKey | PQUWPPDQOKIPLV-FQEVSTJZSA-N |
| XLogP | 3.49 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|