C23H26ClN5O4S2 — CID 133159647
1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 133159647) has the molecular formula C23H26ClN5O4S2 and a molecular weight of 536.08 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133159647 |
| Molecular Formula | C23H26ClN5O4S2 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCSc3n[nH]c(-c4ccccc4)n3)C2)cc1Cl |
| InChI | InChI=1S/C23H26ClN5O4S2/c1-33-20-10-9-18(14-19(20)24)35(31,32)29-12-5-8-17(15-29)22(30)25-11-13-34-23-26-21(27-28-23)16-6-3-2-4-7-16/h2-4,6-7,9-10,14,17H,5,8,11-13,15H2,1H3,(H,25,30)(H,26,27,28) |
| InChIKey | HDVYNJLHZTVMHC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|