C17H23N5O3S2 — CID 100798768
1-(4-methylphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-4-carboxamide (PubChem CID 100798768) has the molecular formula C17H23N5O3S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100798768 |
| Molecular Formula | C17H23N5O3S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCSc3ncn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C17H23N5O3S2/c1-13-2-4-15(5-3-13)27(24,25)22-9-6-14(7-10-22)16(23)18-8-11-26-17-19-12-20-21-17/h2-5,12,14H,6-11H2,1H3,(H,18,23)(H,19,20,21) |
| InChIKey | YEUNIMRDURIKEJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|