C24H31N3O3S — CID 38463572
N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 38463572) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 38463572 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCCN3CCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-19-7-9-22(10-8-19)31(29,30)27-17-12-21(13-18-27)24(28)25-14-4-15-26-16-11-20-5-2-3-6-23(20)26/h2-3,5-10,21H,4,11-18H2,1H3,(H,25,28) |
| InChIKey | JTGYEPWUXWTAQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|