C28H32N2O3S — CID 26796402
N-(3,3-diphenylpropyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26796402) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26796402 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-(3,3-diphenylpropyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H32N2O3S/c1-22-12-14-26(15-13-22)34(32,33)30-20-17-25(18-21-30)28(31)29-19-16-27(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,25,27H,16-21H2,1H3,(H,29,31) |
| InChIKey | KQVQFJOGXHNHQP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |