C19H23FN2O3S3 — CID 24502025
1-(4-fluorophenyl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide (PubChem CID 24502025) has the molecular formula C19H23FN2O3S3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24502025 |
| Molecular Formula | C19H23FN2O3S3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccsc1)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H23FN2O3S3/c20-17-3-5-18(6-4-17)28(24,25)22-9-1-2-16(12-22)19(23)21-8-11-27-14-15-7-10-26-13-15/h3-7,10,13,16H,1-2,8-9,11-12,14H2,(H,21,23) |
| InChIKey | CETDLXRCFUYNMW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|