C18H24N2O3S4 — CID 42940551
1-(5-methylthiophen-2-yl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide (PubChem CID 42940551) has the molecular formula C18H24N2O3S4 and a molecular weight of 444.67 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(5-methylthiophen-2-yl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42940551 |
| Molecular Formula | C18H24N2O3S4 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)sulfonyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCSCc3ccsc3)C2)s1 |
| InChI | InChI=1S/C18H24N2O3S4/c1-14-4-5-17(26-14)27(22,23)20-8-2-3-16(11-20)18(21)19-7-10-25-13-15-6-9-24-12-15/h4-6,9,12,16H,2-3,7-8,10-11,13H2,1H3,(H,19,21) |
| InChIKey | HUUHNOSBBBHEGC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|