C20H34N4O3S2 — CID 55656566
N-[4-(4-methylpiperazin-1-yl)butyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 55656566) has the molecular formula C20H34N4O3S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)butyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)butyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55656566 |
| Molecular Formula | C20H34N4O3S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)butyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCCCN3CCN(C)CC3)C2)s1 |
| InChI | InChI=1S/C20H34N4O3S2/c1-17-7-8-19(28-17)29(26,27)24-11-5-6-18(16-24)20(25)21-9-3-4-10-23-14-12-22(2)13-15-23/h7-8,18H,3-6,9-16H2,1-2H3,(H,21,25) |
| InChIKey | OUJFKINGHCJPOB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|