C17H24N4O3S2 — CID 134057571
N-(3-imidazol-1-ylpropyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 134057571) has the molecular formula C17H24N4O3S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 134057571 |
| Molecular Formula | C17H24N4O3S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCCn3ccnc3)C2)s1 |
| InChI | InChI=1S/C17H24N4O3S2/c1-14-5-6-16(25-14)26(23,24)21-10-2-4-15(12-21)17(22)19-7-3-9-20-11-8-18-13-20/h5-6,8,11,13,15H,2-4,7,9-10,12H2,1H3,(H,19,22) |
| InChIKey | CZLQJXYLZMKVEW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|