C24H30N4O3S2 — CID 46426869
N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 46426869) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46426869 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCCc3cn(-c4ccccc4)nc3C)C2)s1 |
| InChI | InChI=1S/C24H30N4O3S2/c1-18-12-13-23(32-18)33(30,31)27-15-7-9-21(16-27)24(29)25-14-6-8-20-17-28(26-19(20)2)22-10-4-3-5-11-22/h3-5,10-13,17,21H,6-9,14-16H2,1-2H3,(H,25,29) |
| InChIKey | HVENSTDYJXZYCS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|