C21H28N2O4S2 — CID 55717146
N-[2-(2,6-dimethylphenoxy)ethyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 55717146) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)ethyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(2,6-dimethylphenoxy)ethyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55717146 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)ethyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCOc3c(C)cccc3C)C2)s1 |
| InChI | InChI=1S/C21H28N2O4S2/c1-15-6-4-7-16(2)20(15)27-13-11-22-21(24)18-8-5-12-23(14-18)29(25,26)19-10-9-17(3)28-19/h4,6-7,9-10,18H,5,8,11-14H2,1-3H3,(H,22,24) |
| InChIKey | AAZIBVUVMYMKIQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|