C22H26Cl2N2O3S2 — CID 133167972
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 133167972) has the molecular formula C22H26Cl2N2O3S2 and a molecular weight of 501.50 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133167972 |
| Molecular Formula | C22H26Cl2N2O3S2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCSCc3c(Cl)cccc3Cl)C2)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O3S2/c1-16-7-9-18(10-8-16)31(28,29)26-12-3-4-17(14-26)22(27)25-11-13-30-15-19-20(23)5-2-6-21(19)24/h2,5-10,17H,3-4,11-15H2,1H3,(H,25,27) |
| InChIKey | ZZSCPXJSSORTDI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|