C21H25FN2O3S2 — CID 92535844
1-(benzenesulfonyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 92535844) has the molecular formula C21H25FN2O3S2 and a molecular weight of 436.57 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92535844 |
| Molecular Formula | C21H25FN2O3S2 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1F)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25FN2O3S2/c22-20-9-5-4-6-18(20)16-28-15-12-23-21(25)17-10-13-24(14-11-17)29(26,27)19-7-2-1-3-8-19/h1-9,17H,10-16H2,(H,23,25) |
| InChIKey | SJKPNQITXNZLAS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|