C23H26ClFN2O3S — CID 55622930
1-(5-chloro-2-methoxybenzoyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 55622930) has the molecular formula C23H26ClFN2O3S and a molecular weight of 464.99 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxybenzoyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxybenzoyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55622930 |
| Molecular Formula | C23H26ClFN2O3S |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-(5-chloro-2-methoxybenzoyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)NCCSCc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H26ClFN2O3S/c1-30-21-7-6-18(24)14-19(21)23(29)27-11-8-16(9-12-27)22(28)26-10-13-31-15-17-4-2-3-5-20(17)25/h2-7,14,16H,8-13,15H2,1H3,(H,26,28) |
| InChIKey | DALWYBHZHVCKMO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|