C18H20FNO3S — CID 51196870
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide (PubChem CID 51196870) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 51196870 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NCCSCc2ccccc2F)c1 |
| InChI | InChI=1S/C18H20FNO3S/c1-22-14-7-8-17(23-2)15(11-14)18(21)20-9-10-24-12-13-5-3-4-6-16(13)19/h3-8,11H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | PJVXQLALVWNSDT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|