C19H20N2O3S — CID 8757159
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide (PubChem CID 8757159) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 8757159 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NCCSCc2ccccc2C#N)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-23-16-7-8-18(24-2)17(11-16)19(22)21-9-10-25-13-15-6-4-3-5-14(15)12-20/h3-8,11H,9-10,13H2,1-2H3,(H,21,22) |
| InChIKey | PRTFLHQSIONYQI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|