C15H14N2OS2 — CID 8757192
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]thiophene-3-carboxamide (PubChem CID 8757192) has the molecular formula C15H14N2OS2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 8757192 |
| Molecular Formula | C15H14N2OS2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]thiophene-3-carboxamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C15H14N2OS2/c16-9-12-3-1-2-4-13(12)10-20-8-6-17-15(18)14-5-7-19-11-14/h1-5,7,11H,6,8,10H2,(H,17,18) |
| InChIKey | DCHPLGYUWQRAIW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|