C18H17ClN2O3S2 — CID 17495051
4-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methylsulfonylbenzamide (PubChem CID 17495051) has the molecular formula C18H17ClN2O3S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 4-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 17495051 |
| Molecular Formula | C18H17ClN2O3S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)NCCSCc2ccccc2C#N)ccc1Cl |
| InChI | InChI=1S/C18H17ClN2O3S2/c1-26(23,24)17-10-13(6-7-16(17)19)18(22)21-8-9-25-12-15-5-3-2-4-14(15)11-20/h2-7,10H,8-9,12H2,1H3,(H,21,22) |
| InChIKey | YUGFEIARCXRZEZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|