C24H29N3O3S2 — CID 46653351
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 46653351) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 46653351 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)NCCSCc3ccccc3C#N)c2)C1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-18-12-19(2)16-27(15-18)32(29,30)23-9-5-8-20(13-23)24(28)26-10-11-31-17-22-7-4-3-6-21(22)14-25/h3-9,13,18-19H,10-12,15-17H2,1-2H3,(H,26,28) |
| InChIKey | BHBSYRZZJVWBQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|