C22H27FN2O4S2 — CID 55381533
3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 55381533) has the molecular formula C22H27FN2O4S2 and a molecular weight of 466.60 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 55381533 |
| Molecular Formula | C22H27FN2O4S2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)NCCSCc3ccccc3F)c2)CC(C)O1 |
| InChI | InChI=1S/C22H27FN2O4S2/c1-16-13-25(14-17(2)29-16)31(27,28)20-8-5-7-18(12-20)22(26)24-10-11-30-15-19-6-3-4-9-21(19)23/h3-9,12,16-17H,10-11,13-15H2,1-2H3,(H,24,26) |
| InChIKey | MLTQAZDEPQBTEB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|