C21H33N3O5S — CID 55742045
3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(4-morpholin-4-ylbutyl)benzamide (PubChem CID 55742045) has the molecular formula C21H33N3O5S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(4-morpholin-4-ylbutyl)benzamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(4-morpholin-4-ylbutyl)benzamide |
|---|---|
| PubChem CID | 55742045 |
| Molecular Formula | C21H33N3O5S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(4-morpholin-4-ylbutyl)benzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)NCCCCN3CCOCC3)c2)CC(C)O1 |
| InChI | InChI=1S/C21H33N3O5S/c1-17-15-24(16-18(2)29-17)30(26,27)20-7-5-6-19(14-20)21(25)22-8-3-4-9-23-10-12-28-13-11-23/h5-7,14,17-18H,3-4,8-13,15-16H2,1-2H3,(H,22,25) |
| InChIKey | QKQJRGFPWXAAPM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|