C20H32N2O5S — CID 55407954
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 55407954) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55407954 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1cccc(S(=O)(=O)N2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C20H32N2O5S/c1-16-12-17(2)15-22(14-16)28(24,25)19-7-4-6-18(13-19)20(23)21-8-5-9-27-11-10-26-3/h4,6-7,13,16-17H,5,8-12,14-15H2,1-3H3,(H,21,23) |
| InChIKey | KSADBZLSKCIGBI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|