C26H36N2O5S — CID 16548990
N-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 16548990) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 16548990 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cccc(S(=O)(=O)N3CC(C)CC(C)C3)c2)cc1OCC |
| InChI | InChI=1S/C26H36N2O5S/c1-5-32-24-11-10-21(15-25(24)33-6-2)12-13-27-26(29)22-8-7-9-23(16-22)34(30,31)28-17-19(3)14-20(4)18-28/h7-11,15-16,19-20H,5-6,12-14,17-18H2,1-4H3,(H,27,29) |
| InChIKey | DPSOEOPYKVOKJK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |