C19H30N2O6S — CID 55407992
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 55407992) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55407992 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1ccc(S(=O)(=O)N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C19H30N2O6S/c1-15-13-21(14-16(2)27-15)28(23,24)18-7-5-17(6-8-18)19(22)20-9-4-10-26-12-11-25-3/h5-8,15-16H,4,9-14H2,1-3H3,(H,20,22) |
| InChIKey | TZQISBDWHGHNII-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|