C18H30N3O4S+ — CID 8886355
3-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]amino]propyl-dimethylazanium (PubChem CID 8886355) has the molecular formula C18H30N3O4S+ and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8886355 |
| Molecular Formula | C18H30N3O4S+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]amino]propyl-dimethylazanium |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)NCCC[NH+](C)C)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H29N3O4S/c1-14-12-21(13-15(2)25-14)26(23,24)17-8-6-16(7-9-17)18(22)19-10-5-11-20(3)4/h6-9,14-15H,5,10-13H2,1-4H3,(H,19,22)/p+1/t14-,15+ |
| InChIKey | ZZWCXFCISAZPOZ-GASCZTMLSA-O |
| XLogP | -0.25 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|