C20H23FN2O4S — CID 4810896
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 4810896) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 4810896 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)NCc3ccc(F)cc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H23FN2O4S/c1-14-12-23(13-15(2)27-14)28(25,26)19-9-5-17(6-10-19)20(24)22-11-16-3-7-18(21)8-4-16/h3-10,14-15H,11-13H2,1-2H3,(H,22,24) |
| InChIKey | HOXNJKNFDPDOMH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |