C19H20N2OS — CID 46653390
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,3-dimethylbenzamide (PubChem CID 46653390) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,3-dimethylbenzamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 46653390 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCSCc2ccccc2C#N)c1C |
| InChI | InChI=1S/C19H20N2OS/c1-14-6-5-9-18(15(14)2)19(22)21-10-11-23-13-17-8-4-3-7-16(17)12-20/h3-9H,10-11,13H2,1-2H3,(H,21,22) |
| InChIKey | VGPQJNGBBDSBFZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|