C21H24N2O2S — CID 8757113
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 8757113) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 8757113 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NCCSCc2ccccc2C#N)c(C)c1 |
| InChI | InChI=1S/C21H24N2O2S/c1-15-10-16(2)21(17(3)11-15)25-13-20(24)23-8-9-26-14-19-7-5-4-6-18(19)12-22/h4-7,10-11H,8-9,13-14H2,1-3H3,(H,23,24) |
| InChIKey | UWBIPYNZTJXKMI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|