C20H22N2O3S2 — CID 8757103
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 8757103) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 8757103 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NCCSCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-16-6-8-19(9-7-16)27(24,25)13-10-20(23)22-11-12-26-15-18-5-3-2-4-17(18)14-21/h2-9H,10-13,15H2,1H3,(H,22,23) |
| InChIKey | HYJILSILNRYFNZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|