C19H23NO3S2 — CID 8749612
N-(2-benzylsulfanylethyl)-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 8749612) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-(2-benzylsulfanylethyl)-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 8749612 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NCCSCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO3S2/c1-16-7-9-18(10-8-16)25(22,23)14-11-19(21)20-12-13-24-15-17-5-3-2-4-6-17/h2-10H,11-15H2,1H3,(H,20,21) |
| InChIKey | WZOFQLVXLOKKML-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|