C17H20N2O3S — CID 86930314
3-(4-methylphenyl)sulfonyl-N-(2-pyridin-3-ylethyl)propanamide (PubChem CID 86930314) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-N-(2-pyridin-3-ylethyl)propanamide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-N-(2-pyridin-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 86930314 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-N-(2-pyridin-3-ylethyl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NCCc2cccnc2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-14-4-6-16(7-5-14)23(21,22)12-9-17(20)19-11-8-15-3-2-10-18-13-15/h2-7,10,13H,8-9,11-12H2,1H3,(H,19,20) |
| InChIKey | UXPQGSDVEYRIQI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |