C23H28ClN3O3 — CID 56586390
N-(3-anilinopropyl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide (PubChem CID 56586390) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-(3-anilinopropyl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(3-anilinopropyl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56586390 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-(3-anilinopropyl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)NCCCNc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O3/c1-30-21-9-8-18(24)16-20(21)23(29)27-14-10-17(11-15-27)22(28)26-13-5-12-25-19-6-3-2-4-7-19/h2-4,6-9,16-17,25H,5,10-15H2,1H3,(H,26,28) |
| InChIKey | WVADALCRCVQFAB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|