C26H32ClN3O3 — CID 55653629
N-(1-benzylpiperidin-3-yl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide (PubChem CID 55653629) has the molecular formula C26H32ClN3O3 and a molecular weight of 470.01 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55653629 |
| Molecular Formula | C26H32ClN3O3 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)NC2CCCN(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C26H32ClN3O3/c1-33-24-10-9-21(27)16-23(24)26(32)30-14-11-20(12-15-30)25(31)28-22-8-5-13-29(18-22)17-19-6-3-2-4-7-19/h2-4,6-7,9-10,16,20,22H,5,8,11-15,17-18H2,1H3,(H,28,31) |
| InChIKey | WILGYHQENRHGGC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |